C22H29N7 — CID 126932605
4-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5,6-dimethylpyrrolo[3,2-d]pyrimidine (PubChem CID 126932605) has the molecular formula C22H29N7 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5,6-dimethylpyrrolo[3,2-d]pyrimidine.
| Compound Name | 4-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5,6-dimethylpyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 126932605 |
| Molecular Formula | C22H29N7 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 4-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5,6-dimethylpyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1cc2ncnc(N3CC4CN(c5cc(C(C)(C)C)ncn5)CC4C3)c2n1C |
| InChI | InChI=1S/C22H29N7/c1-14-6-17-20(27(14)5)21(26-12-23-17)29-10-15-8-28(9-16(15)11-29)19-7-18(22(2,3)4)24-13-25-19/h6-7,12-13,15-16H,8-11H2,1-5H3 |
| InChIKey | IEOWPSZUBWUGTJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |