C21H28N8O — CID 126932599
6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,5-dimethylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 126932599) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is 6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,5-dimethylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,5-dimethylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 126932599 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1,5-dimethylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1c(N2CC3CN(c4cc(C(C)(C)C)ncn4)CC3C2)nc2c(cnn2C)c1=O |
| InChI | InChI=1S/C21H28N8O/c1-21(2,3)16-6-17(23-12-22-16)28-8-13-10-29(11-14(13)9-28)20-25-18-15(7-24-27(18)5)19(30)26(20)4/h6-7,12-14H,8-11H2,1-5H3 |
| InChIKey | PELQHKCVTXCSNQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |