C24H23N5O2 — CID 126936213
N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]-1H-indole-3-carboxamide (PubChem CID 126936213) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]-1H-indole-3-carboxamide.
| Compound Name | N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 126936213 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NC1CCC(n2nc(-c3cccnc3)ccc2=O)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H23N5O2/c30-23-12-11-21(16-4-3-13-25-14-16)28-29(23)18-9-7-17(8-10-18)27-24(31)20-15-26-22-6-2-1-5-19(20)22/h1-6,11-15,17-18,26H,7-10H2,(H,27,31) |
| InChIKey | FHRBGAAIZAYXJD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |