C20H22N6O2 — CID 126936292
2-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]pyrazole-3-carboxamide (PubChem CID 126936292) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]pyrazole-3-carboxamide.
| Compound Name | 2-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126936292 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)cyclohexyl]pyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)NC1CCC(n2nc(-c3cccnc3)ccc2=O)CC1 |
| InChI | InChI=1S/C20H22N6O2/c1-25-18(10-12-22-25)20(28)23-15-4-6-16(7-5-15)26-19(27)9-8-17(24-26)14-3-2-11-21-13-14/h2-3,8-13,15-16H,4-7H2,1H3,(H,23,28) |
| InChIKey | BNTZZHREYPWOSZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |