C13H14FN5O2 — CID 126938817
2-[4-[(5-fluoropyrimidin-2-yl)amino]oxolan-3-yl]-6-methylpyridazin-3-one (PubChem CID 126938817) has the molecular formula C13H14FN5O2 and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[4-[(5-fluoropyrimidin-2-yl)amino]oxolan-3-yl]-6-methylpyridazin-3-one.
| Compound Name | 2-[4-[(5-fluoropyrimidin-2-yl)amino]oxolan-3-yl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126938817 |
| Molecular Formula | C13H14FN5O2 |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[4-[(5-fluoropyrimidin-2-yl)amino]oxolan-3-yl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(C2COCC2Nc2ncc(F)cn2)n1 |
| InChI | InChI=1S/C13H14FN5O2/c1-8-2-3-12(20)19(18-8)11-7-21-6-10(11)17-13-15-4-9(14)5-16-13/h2-5,10-11H,6-7H2,1H3,(H,15,16,17) |
| InChIKey | DYWAMYWKAOMWSM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |