C14H14F3N5O2 — CID 126938821
6-methyl-2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-yl]pyridazin-3-one (PubChem CID 126938821) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 6-methyl-2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-yl]pyridazin-3-one.
| Compound Name | 6-methyl-2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126938821 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 6-methyl-2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-yl]pyridazin-3-one |
| SMILES | Cc1ccc(=O)n(C2COCC2Nc2nccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C14H14F3N5O2/c1-8-2-3-12(23)22(21-8)10-7-24-6-9(10)19-13-18-5-4-11(20-13)14(15,16)17/h2-5,9-10H,6-7H2,1H3,(H,18,19,20) |
| InChIKey | SFPHCEFWOBBKEZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |