C21H21N3O5 — CID 126938938
N-[4-(3-cyclopropyl-6-oxopyridazin-1-yl)oxolan-3-yl]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 126938938) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[4-(3-cyclopropyl-6-oxopyridazin-1-yl)oxolan-3-yl]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(3-cyclopropyl-6-oxopyridazin-1-yl)oxolan-3-yl]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126938938 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[4-(3-cyclopropyl-6-oxopyridazin-1-yl)oxolan-3-yl]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NC3COCC3n3nc(C4CC4)ccc3=O)oc12 |
| InChI | InChI=1S/C21H21N3O5/c1-27-17-4-2-3-13-9-18(29-20(13)17)21(26)22-15-10-28-11-16(15)24-19(25)8-7-14(23-24)12-5-6-12/h2-4,7-9,12,15-16H,5-6,10-11H2,1H3,(H,22,26) |
| InChIKey | KVWNTFHPDWNNBN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |