C22H18N4O4 — CID 126940035
N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]-1-benzofuran-2-carboxamide (PubChem CID 126940035) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126940035 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1COCC1n1nc(-c2cccnc2)ccc1=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H18N4O4/c27-21-8-7-16(15-5-3-9-23-11-15)25-26(21)18-13-29-12-17(18)24-22(28)20-10-14-4-1-2-6-19(14)30-20/h1-11,17-18H,12-13H2,(H,24,28) |
| InChIKey | UJPSFCSXGFAEIY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |