C22H19N5O3 — CID 126940248
N-[4-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)oxolan-3-yl]-1H-indole-5-carboxamide (PubChem CID 126940248) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-[4-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)oxolan-3-yl]-1H-indole-5-carboxamide.
| Compound Name | N-[4-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)oxolan-3-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 126940248 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[4-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)oxolan-3-yl]-1H-indole-5-carboxamide |
| SMILES | O=C(NC1COCC1n1nc(-c2ccncc2)ccc1=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C22H19N5O3/c28-21-4-3-18(14-5-8-23-9-6-14)26-27(21)20-13-30-12-19(20)25-22(29)16-1-2-17-15(11-16)7-10-24-17/h1-11,19-20,24H,12-13H2,(H,25,29) |
| InChIKey | AFRSYJBVWVIVEB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |