C19H18N4O3S — CID 126940065
5-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]thiophene-2-carboxamide (PubChem CID 126940065) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 5-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126940065 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-methyl-N-[4-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)oxolan-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2COCC2n2nc(-c3cccnc3)ccc2=O)s1 |
| InChI | InChI=1S/C19H18N4O3S/c1-12-4-6-17(27-12)19(25)21-15-10-26-11-16(15)23-18(24)7-5-14(22-23)13-3-2-8-20-9-13/h2-9,15-16H,10-11H2,1H3,(H,21,25) |
| InChIKey | IEEOOSWATJEKQU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |