C21H21ClN4O3 — CID 126940339
2-[4-[(2-chloro-3-methoxyphenyl)methylamino]oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one (PubChem CID 126940339) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is 2-[4-[(2-chloro-3-methoxyphenyl)methylamino]oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one.
| Compound Name | 2-[4-[(2-chloro-3-methoxyphenyl)methylamino]oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 126940339 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[4-[(2-chloro-3-methoxyphenyl)methylamino]oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one |
| SMILES | COc1cccc(CNC2COCC2n2nc(-c3ccncc3)ccc2=O)c1Cl |
| InChI | InChI=1S/C21H21ClN4O3/c1-28-19-4-2-3-15(21(19)22)11-24-17-12-29-13-18(17)26-20(27)6-5-16(25-26)14-7-9-23-10-8-14/h2-10,17-18,24H,11-13H2,1H3 |
| InChIKey | OIDUOYPGZWXCMK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |