C17H20N4O2 — CID 126940299
2-[4-(cyclopropylmethylamino)oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one (PubChem CID 126940299) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethylamino)oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one.
| Compound Name | 2-[4-(cyclopropylmethylamino)oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 126940299 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[4-(cyclopropylmethylamino)oxolan-3-yl]-6-pyridin-4-ylpyridazin-3-one |
| SMILES | O=c1ccc(-c2ccncc2)nn1C1COCC1NCC1CC1 |
| InChI | InChI=1S/C17H20N4O2/c22-17-4-3-14(13-5-7-18-8-6-13)20-21(17)16-11-23-10-15(16)19-9-12-1-2-12/h3-8,12,15-16,19H,1-2,9-11H2 |
| InChIKey | WKLSGXORLAPHIA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |