C20H18N6O2 — CID 126940480
2-[4-(isoquinolin-1-ylamino)oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one (PubChem CID 126940480) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[4-(isoquinolin-1-ylamino)oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one.
| Compound Name | 2-[4-(isoquinolin-1-ylamino)oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one |
|---|---|
| PubChem CID | 126940480 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[4-(isoquinolin-1-ylamino)oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one |
| SMILES | O=c1ccc(-n2cccn2)nn1C1COCC1Nc1nccc2ccccc12 |
| InChI | InChI=1S/C20H18N6O2/c27-19-7-6-18(25-11-3-9-22-25)24-26(19)17-13-28-12-16(17)23-20-15-5-2-1-4-14(15)8-10-21-20/h1-11,16-17H,12-13H2,(H,21,23) |
| InChIKey | JUZIVVJPPXEEGV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |