C20H19N7O2 — CID 126940482
2-[4-[(3-methylquinoxalin-2-yl)amino]oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one (PubChem CID 126940482) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[4-[(3-methylquinoxalin-2-yl)amino]oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one.
| Compound Name | 2-[4-[(3-methylquinoxalin-2-yl)amino]oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one |
|---|---|
| PubChem CID | 126940482 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[4-[(3-methylquinoxalin-2-yl)amino]oxolan-3-yl]-6-pyrazol-1-ylpyridazin-3-one |
| SMILES | Cc1nc2ccccc2nc1NC1COCC1n1nc(-n2cccn2)ccc1=O |
| InChI | InChI=1S/C20H19N7O2/c1-13-20(23-15-6-3-2-5-14(15)22-13)24-16-11-29-12-17(16)27-19(28)8-7-18(25-27)26-10-4-9-21-26/h2-10,16-17H,11-12H2,1H3,(H,23,24) |
| InChIKey | HRMXPAKKEFXQGL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |