C16H23N5O — CID 126940731
5-methyl-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]pyrimidin-4-one (PubChem CID 126940731) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-methyl-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]pyrimidin-4-one.
| Compound Name | 5-methyl-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 126940731 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 5-methyl-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]pyrimidin-4-one |
| SMILES | Cc1cncn(CC2CCN(CCn3cccn3)CC2)c1=O |
| InChI | InChI=1S/C16H23N5O/c1-14-11-17-13-20(16(14)22)12-15-3-7-19(8-4-15)9-10-21-6-2-5-18-21/h2,5-6,11,13,15H,3-4,7-10,12H2,1H3 |
| InChIKey | FFIHFXVVGSYMCL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |