C20H25N5O2 — CID 154883158
7-methoxy-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]quinazolin-4-one (PubChem CID 154883158) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 7-methoxy-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]quinazolin-4-one.
| Compound Name | 7-methoxy-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 154883158 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 7-methoxy-3-[[1-(2-pyrazol-1-ylethyl)piperidin-4-yl]methyl]quinazolin-4-one |
| SMILES | COc1ccc2c(=O)n(CC3CCN(CCn4cccn4)CC3)cnc2c1 |
| InChI | InChI=1S/C20H25N5O2/c1-27-17-3-4-18-19(13-17)21-15-24(20(18)26)14-16-5-9-23(10-6-16)11-12-25-8-2-7-22-25/h2-4,7-8,13,15-16H,5-6,9-12,14H2,1H3 |
| InChIKey | SDTJHLBHEZICOK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |