C23H24ClN3O3 — CID 154581941
3-[[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]methyl]-7-methoxyquinazolin-4-one (PubChem CID 154581941) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-[[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]methyl]-7-methoxyquinazolin-4-one.
| Compound Name | 3-[[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]methyl]-7-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 154581941 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]methyl]-7-methoxyquinazolin-4-one |
| SMILES | COc1ccc2c(=O)n(CC3CCN(C(=O)Cc4ccccc4Cl)CC3)cnc2c1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-30-18-6-7-19-21(13-18)25-15-27(23(19)29)14-16-8-10-26(11-9-16)22(28)12-17-4-2-3-5-20(17)24/h2-7,13,15-16H,8-12,14H2,1H3 |
| InChIKey | AVNLCCXBCYYDJV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |