C23H23N5O2 — CID 154581310
7-methoxy-3-[(1-quinoxalin-2-ylpiperidin-4-yl)methyl]quinazolin-4-one (PubChem CID 154581310) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-methoxy-3-[(1-quinoxalin-2-ylpiperidin-4-yl)methyl]quinazolin-4-one.
| Compound Name | 7-methoxy-3-[(1-quinoxalin-2-ylpiperidin-4-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 154581310 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 7-methoxy-3-[(1-quinoxalin-2-ylpiperidin-4-yl)methyl]quinazolin-4-one |
| SMILES | COc1ccc2c(=O)n(CC3CCN(c4cnc5ccccc5n4)CC3)cnc2c1 |
| InChI | InChI=1S/C23H23N5O2/c1-30-17-6-7-18-21(12-17)25-15-28(23(18)29)14-16-8-10-27(11-9-16)22-13-24-19-4-2-3-5-20(19)26-22/h2-7,12-13,15-16H,8-11,14H2,1H3 |
| InChIKey | KAHHIXXBOWIPKY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |