C22H20ClN5O — CID 154883282
3-[[1-(6-chloroquinoxalin-2-yl)piperidin-4-yl]methyl]quinazolin-4-one (PubChem CID 154883282) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 3-[[1-(6-chloroquinoxalin-2-yl)piperidin-4-yl]methyl]quinazolin-4-one.
| Compound Name | 3-[[1-(6-chloroquinoxalin-2-yl)piperidin-4-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 154883282 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-[[1-(6-chloroquinoxalin-2-yl)piperidin-4-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CC1CCN(c2cnc3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C22H20ClN5O/c23-16-5-6-19-20(11-16)24-12-21(26-19)27-9-7-15(8-10-27)13-28-14-25-18-4-2-1-3-17(18)22(28)29/h1-6,11-12,14-15H,7-10,13H2 |
| InChIKey | JQUJJKVQDIGAKA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |