C15H18F3N3O2 — CID 126943354
3-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 126943354) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 3-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 126943354 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | O=C(C1CC1)N1CCC(Cn2cnc(C(F)(F)F)cc2=O)CC1 |
| InChI | InChI=1S/C15H18F3N3O2/c16-15(17,18)12-7-13(22)21(9-19-12)8-10-3-5-20(6-4-10)14(23)11-1-2-11/h7,9-11H,1-6,8H2 |
| InChIKey | BWUODFJLFAYNRY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |