C17H24F3N3O2 — CID 126943687
3-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 126943687) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 3-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 126943687 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[[1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)F)ncn1CC1CCN(CC2CCOCC2)CC1 |
| InChI | InChI=1S/C17H24F3N3O2/c18-17(19,20)15-9-16(24)23(12-21-15)11-13-1-5-22(6-2-13)10-14-3-7-25-8-4-14/h9,12-14H,1-8,10-11H2 |
| InChIKey | PKDZJQCXMOVVEB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |