C17H16N6 — CID 126947693
1-[1-(3-methylquinoxalin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile (PubChem CID 126947693) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-[1-(3-methylquinoxalin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 1-[1-(3-methylquinoxalin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 126947693 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[1-(3-methylquinoxalin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile |
| SMILES | Cc1nc2ccccc2nc1N1CCC(n2cc(C#N)cn2)C1 |
| InChI | InChI=1S/C17H16N6/c1-12-17(21-16-5-3-2-4-15(16)20-12)22-7-6-14(11-22)23-10-13(8-18)9-19-23/h2-5,9-10,14H,6-7,11H2,1H3 |
| InChIKey | MSPAIZQGNRZOEJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |