C13H14N6 — CID 126947717
1-[1-(6-methylpyrazin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile (PubChem CID 126947717) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-[1-(6-methylpyrazin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 1-[1-(6-methylpyrazin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 126947717 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-[1-(6-methylpyrazin-2-yl)pyrrolidin-3-yl]pyrazole-4-carbonitrile |
| SMILES | Cc1cncc(N2CCC(n3cc(C#N)cn3)C2)n1 |
| InChI | InChI=1S/C13H14N6/c1-10-5-15-7-13(17-10)18-3-2-12(9-18)19-8-11(4-14)6-16-19/h5-8,12H,2-3,9H2,1H3 |
| InChIKey | CMPMMNSFSMMARS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |