C22H25N5O — CID 126950043
3-cyclopentyl-2-[1-(5-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 126950043) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 3-cyclopentyl-2-[1-(5-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 3-cyclopentyl-2-[1-(5-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126950043 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-cyclopentyl-2-[1-(5-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | Cc1cnc(N2CCCC2c2nc3ccccc3c(=O)n2C2CCCC2)cn1 |
| InChI | InChI=1S/C22H25N5O/c1-15-13-24-20(14-23-15)26-12-6-11-19(26)21-25-18-10-5-4-9-17(18)22(28)27(21)16-7-2-3-8-16/h4-5,9-10,13-14,16,19H,2-3,6-8,11-12H2,1H3 |
| InChIKey | GCPWVWQMDKBPDX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |