C18H19N5O — CID 126949401
3-methyl-2-[1-(6-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 126949401) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-methyl-2-[1-(6-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 3-methyl-2-[1-(6-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126949401 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-methyl-2-[1-(6-methylpyrazin-2-yl)pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | Cc1cncc(N2CCCC2c2nc3ccccc3c(=O)n2C)n1 |
| InChI | InChI=1S/C18H19N5O/c1-12-10-19-11-16(20-12)23-9-5-8-15(23)17-21-14-7-4-3-6-13(14)18(24)22(17)2/h3-4,6-7,10-11,15H,5,8-9H2,1-2H3 |
| InChIKey | UAEZDNDPFFIRIT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |