C23H23N5O3 — CID 126951068
3-(2-hydroxyethyl)-2-[1-(3-methyl-4-oxoquinazolin-2-yl)pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 126951068) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2-[1-(3-methyl-4-oxoquinazolin-2-yl)pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-2-[1-(3-methyl-4-oxoquinazolin-2-yl)pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126951068 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-(2-hydroxyethyl)-2-[1-(3-methyl-4-oxoquinazolin-2-yl)pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | Cn1c(N2CCCC2c2nc3ccccc3c(=O)n2CCO)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H23N5O3/c1-26-21(30)15-7-2-5-10-18(15)25-23(26)27-12-6-11-19(27)20-24-17-9-4-3-8-16(17)22(31)28(20)13-14-29/h2-5,7-10,19,29H,6,11-14H2,1H3 |
| InChIKey | NNENQJQTQVKLLW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |