C19H19N5O3 — CID 126950746
3-(2-hydroxyethyl)-2-[1-(pyrimidine-2-carbonyl)pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 126950746) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2-[1-(pyrimidine-2-carbonyl)pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-2-[1-(pyrimidine-2-carbonyl)pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126950746 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-(2-hydroxyethyl)-2-[1-(pyrimidine-2-carbonyl)pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | O=C(c1ncccn1)N1CCCC1c1nc2ccccc2c(=O)n1CCO |
| InChI | InChI=1S/C19H19N5O3/c25-12-11-24-17(22-14-6-2-1-5-13(14)18(24)26)15-7-3-10-23(15)19(27)16-20-8-4-9-21-16/h1-2,4-6,8-9,15,25H,3,7,10-12H2 |
| InChIKey | SBRUNRZPZWIORH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |