C20H25N3O3 — CID 126950695
2-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-3-(2-hydroxyethyl)quinazolin-4-one (PubChem CID 126950695) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-3-(2-hydroxyethyl)quinazolin-4-one.
| Compound Name | 2-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-3-(2-hydroxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126950695 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[1-(cyclopentanecarbonyl)pyrrolidin-2-yl]-3-(2-hydroxyethyl)quinazolin-4-one |
| SMILES | O=C(C1CCCC1)N1CCCC1c1nc2ccccc2c(=O)n1CCO |
| InChI | InChI=1S/C20H25N3O3/c24-13-12-23-18(21-16-9-4-3-8-15(16)20(23)26)17-10-5-11-22(17)19(25)14-6-1-2-7-14/h3-4,8-9,14,17,24H,1-2,5-7,10-13H2 |
| InChIKey | CKVKDRBGVJQBPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |