C23H28N4O2 — CID 126952400
5-[[4-[1-(cyclopropylmethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-1-methylpyrazin-2-one (PubChem CID 126952400) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-[[4-[1-(cyclopropylmethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-1-methylpyrazin-2-one.
| Compound Name | 5-[[4-[1-(cyclopropylmethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 126952400 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 5-[[4-[1-(cyclopropylmethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-1-methylpyrazin-2-one |
| SMILES | Cn1cc(CN2CCC(Oc3cccc4c3ccn4CC3CC3)CC2)ncc1=O |
| InChI | InChI=1S/C23H28N4O2/c1-25-15-18(24-13-23(25)28)16-26-10-7-19(8-11-26)29-22-4-2-3-21-20(22)9-12-27(21)14-17-5-6-17/h2-4,9,12-13,15,17,19H,5-8,10-11,14,16H2,1H3 |
| InChIKey | AKHZIHAWGKWLPE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |