C21H25N5O3 — CID 126953482
2-[4-[1-[(1-methyl-2-oxopyrimidin-4-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide (PubChem CID 126953482) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[4-[1-[(1-methyl-2-oxopyrimidin-4-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide.
| Compound Name | 2-[4-[1-[(1-methyl-2-oxopyrimidin-4-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide |
|---|---|
| PubChem CID | 126953482 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[4-[1-[(1-methyl-2-oxopyrimidin-4-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide |
| SMILES | Cn1ccc(CN2CCC(Oc3cccc4c3ccn4CC(N)=O)CC2)nc1=O |
| InChI | InChI=1S/C21H25N5O3/c1-24-9-5-15(23-21(24)28)13-25-10-6-16(7-11-25)29-19-4-2-3-18-17(19)8-12-26(18)14-20(22)27/h2-5,8-9,12,16H,6-7,10-11,13-14H2,1H3,(H2,22,27) |
| InChIKey | CUJJBGNATQJWQX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |