C23H32N4O3 — CID 126953459
2-[4-[1-[(1-methyl-7-oxoazepan-2-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide (PubChem CID 126953459) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[4-[1-[(1-methyl-7-oxoazepan-2-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide.
| Compound Name | 2-[4-[1-[(1-methyl-7-oxoazepan-2-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide |
|---|---|
| PubChem CID | 126953459 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-[4-[1-[(1-methyl-7-oxoazepan-2-yl)methyl]piperidin-4-yl]oxyindol-1-yl]acetamide |
| SMILES | CN1C(=O)CCCCC1CN1CCC(Oc2cccc3c2ccn3CC(N)=O)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-25-17(5-2-3-8-23(25)29)15-26-12-9-18(10-13-26)30-21-7-4-6-20-19(21)11-14-27(20)16-22(24)28/h4,6-7,11,14,17-18H,2-3,5,8-10,12-13,15-16H2,1H3,(H2,24,28) |
| InChIKey | HGKHGUMPAUVMOE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |