C23H26F3N3O2 — CID 126952627
2-[[4-[1-(2,2,2-trifluoroethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 126952627) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[[4-[1-(2,2,2-trifluoroethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 2-[[4-[1-(2,2,2-trifluoroethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 126952627 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[[4-[1-(2,2,2-trifluoroethyl)indol-4-yl]oxypiperidin-1-yl]methyl]-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | FC(F)(F)Cn1ccc2c(OC3CCN(Cc4nc5c(o4)CCCC5)CC3)cccc21 |
| InChI | InChI=1S/C23H26F3N3O2/c24-23(25,26)15-29-13-10-17-19(29)5-3-7-20(17)30-16-8-11-28(12-9-16)14-22-27-18-4-1-2-6-21(18)31-22/h3,5,7,10,13,16H,1-2,4,6,8-9,11-12,14-15H2 |
| InChIKey | AWMWHZCXJIHULO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |