C20H25F3N2O2 — CID 126952690
4-[1-(oxolan-2-ylmethyl)piperidin-4-yl]oxy-1-(2,2,2-trifluoroethyl)indole (PubChem CID 126952690) has the molecular formula C20H25F3N2O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 4-[1-(oxolan-2-ylmethyl)piperidin-4-yl]oxy-1-(2,2,2-trifluoroethyl)indole.
| Compound Name | 4-[1-(oxolan-2-ylmethyl)piperidin-4-yl]oxy-1-(2,2,2-trifluoroethyl)indole |
|---|---|
| PubChem CID | 126952690 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 4-[1-(oxolan-2-ylmethyl)piperidin-4-yl]oxy-1-(2,2,2-trifluoroethyl)indole |
| SMILES | FC(F)(F)Cn1ccc2c(OC3CCN(CC4CCCO4)CC3)cccc21 |
| InChI | InChI=1S/C20H25F3N2O2/c21-20(22,23)14-25-11-8-17-18(25)4-1-5-19(17)27-15-6-9-24(10-7-15)13-16-3-2-12-26-16/h1,4-5,8,11,15-16H,2-3,6-7,9-10,12-14H2 |
| InChIKey | OHQGBKNCBJVYAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |