C23H28N4O2 — CID 126953177
4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]oxy-1-(oxolan-3-yl)indole (PubChem CID 126953177) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]oxy-1-(oxolan-3-yl)indole.
| Compound Name | 4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]oxy-1-(oxolan-3-yl)indole |
|---|---|
| PubChem CID | 126953177 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]oxy-1-(oxolan-3-yl)indole |
| SMILES | Cc1cc(C)nc(N2CCC(Oc3cccc4c3ccn4C3CCOC3)CC2)n1 |
| InChI | InChI=1S/C23H28N4O2/c1-16-14-17(2)25-23(24-16)26-10-6-19(7-11-26)29-22-5-3-4-21-20(22)8-12-27(21)18-9-13-28-15-18/h3-5,8,12,14,18-19H,6-7,9-11,13,15H2,1-2H3 |
| InChIKey | YPDPXUDKEYOVBU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |