C21H25N3O3 — CID 126953281
4-[[4-[1-(oxolan-3-yl)indol-4-yl]oxypiperidin-1-yl]methyl]-1,2-oxazole (PubChem CID 126953281) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[[4-[1-(oxolan-3-yl)indol-4-yl]oxypiperidin-1-yl]methyl]-1,2-oxazole.
| Compound Name | 4-[[4-[1-(oxolan-3-yl)indol-4-yl]oxypiperidin-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 126953281 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-[[4-[1-(oxolan-3-yl)indol-4-yl]oxypiperidin-1-yl]methyl]-1,2-oxazole |
| SMILES | c1cc(OC2CCN(Cc3cnoc3)CC2)c2ccn(C3CCOC3)c2c1 |
| InChI | InChI=1S/C21H25N3O3/c1-2-20-19(6-10-24(20)17-7-11-25-15-17)21(3-1)27-18-4-8-23(9-5-18)13-16-12-22-26-14-16/h1-3,6,10,12,14,17-18H,4-5,7-9,11,13,15H2 |
| InChIKey | CICMPASTRAMYOJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |