C10H10ClF3N2O2 — CID 126954031
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]oxolan-3-amine (PubChem CID 126954031) has the molecular formula C10H10ClF3N2O2 and a molecular weight of 282.65 g/mol. Its IUPAC name is 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]oxolan-3-amine.
| Compound Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]oxolan-3-amine |
|---|---|
| PubChem CID | 126954031 |
| Molecular Formula | C10H10ClF3N2O2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]oxolan-3-amine |
| SMILES | NC1COCC1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H10ClF3N2O2/c11-6-1-5(10(12,13)14)2-16-9(6)18-8-4-17-3-7(8)15/h1-2,7-8H,3-4,15H2 |
| InChIKey | QZYFLPKLCDYFMI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |