C13H18F2N2O — CID 126954339
3-tert-butyl-6-[(3,3-difluorocyclobutyl)methoxy]pyridazine (PubChem CID 126954339) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-tert-butyl-6-[(3,3-difluorocyclobutyl)methoxy]pyridazine.
| Compound Name | 3-tert-butyl-6-[(3,3-difluorocyclobutyl)methoxy]pyridazine |
|---|---|
| PubChem CID | 126954339 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-tert-butyl-6-[(3,3-difluorocyclobutyl)methoxy]pyridazine |
| SMILES | CC(C)(C)c1ccc(OCC2CC(F)(F)C2)nn1 |
| InChI | InChI=1S/C13H18F2N2O/c1-12(2,3)10-4-5-11(17-16-10)18-8-9-6-13(14,15)7-9/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | WZYKCPSYTJWODM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |