C10H12F2N2O2 — CID 126954698
6-[(3,3-difluorocyclobutyl)methoxy]-3-methylpyrimidin-4-one (PubChem CID 126954698) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 6-[(3,3-difluorocyclobutyl)methoxy]-3-methylpyrimidin-4-one.
| Compound Name | 6-[(3,3-difluorocyclobutyl)methoxy]-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 126954698 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-[(3,3-difluorocyclobutyl)methoxy]-3-methylpyrimidin-4-one |
| SMILES | Cn1cnc(OCC2CC(F)(F)C2)cc1=O |
| InChI | InChI=1S/C10H12F2N2O2/c1-14-6-13-8(2-9(14)15)16-5-7-3-10(11,12)4-7/h2,6-7H,3-5H2,1H3 |
| InChIKey | VGPHVDJWLNUADC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |