C20H26ClN2O6+ — CID 126956873
1-carbazol-9-yl-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol;perchloric acid (PubChem CID 126956873) has the molecular formula C20H26ClN2O6+ and a molecular weight of 425.89 g/mol. Its IUPAC name is 1-carbazol-9-yl-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol;perchloric acid.
| Compound Name | 1-carbazol-9-yl-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol;perchloric acid |
|---|---|
| PubChem CID | 126956873 |
| Molecular Formula | C20H26ClN2O6+ |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-carbazol-9-yl-3-(4-methylmorpholin-4-ium-4-yl)propan-2-ol;perchloric acid |
| SMILES | C[N+]1(CC(O)Cn2c3ccccc3c3ccccc32)CCOCC1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C20H25N2O2.ClHO4/c1-22(10-12-24-13-11-22)15-16(23)14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21;2-1(3,4)5/h2-9,16,23H,10-15H2,1H3;(H,2,3,4,5)/q+1; |
| InChIKey | REJRFDWKTPDCDG-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|