C18H20N2O4S — CID 127037260
1-carbazol-9-yl-3-(3,3-dioxo-1,3,4-oxathiazinan-4-yl)propan-2-ol (PubChem CID 127037260) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-carbazol-9-yl-3-(3,3-dioxo-1,3,4-oxathiazinan-4-yl)propan-2-ol.
| Compound Name | 1-carbazol-9-yl-3-(3,3-dioxo-1,3,4-oxathiazinan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 127037260 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-carbazol-9-yl-3-(3,3-dioxo-1,3,4-oxathiazinan-4-yl)propan-2-ol |
| SMILES | O=S1(=O)COCCN1CC(O)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C18H20N2O4S/c21-14(11-19-9-10-24-13-25(19,22)23)12-20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-8,14,21H,9-13H2 |
| InChIKey | UVCKEMWWTQKUEA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |