C19H20F2N2O3S — CID 72544447
1-(2,6-difluorocarbazol-9-yl)-3-(1,1-dioxothiazinan-2-yl)propan-2-ol (PubChem CID 72544447) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-(2,6-difluorocarbazol-9-yl)-3-(1,1-dioxothiazinan-2-yl)propan-2-ol.
| Compound Name | 1-(2,6-difluorocarbazol-9-yl)-3-(1,1-dioxothiazinan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 72544447 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-(2,6-difluorocarbazol-9-yl)-3-(1,1-dioxothiazinan-2-yl)propan-2-ol |
| SMILES | O=S1(=O)CCCCN1CC(O)Cn1c2ccc(F)cc2c2ccc(F)cc21 |
| InChI | InChI=1S/C19H20F2N2O3S/c20-13-4-6-18-17(9-13)16-5-3-14(21)10-19(16)23(18)12-15(24)11-22-7-1-2-8-27(22,25)26/h3-6,9-10,15,24H,1-2,7-8,11-12H2 |
| InChIKey | RVNBVNLGQWBKSJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |