C19H20F2N2OS — CID 135284918
1-(3,5-difluorocarbazol-9-yl)-3-(thiazinan-2-yl)propan-2-ol (PubChem CID 135284918) has the molecular formula C19H20F2N2OS and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(3,5-difluorocarbazol-9-yl)-3-(thiazinan-2-yl)propan-2-ol.
| Compound Name | 1-(3,5-difluorocarbazol-9-yl)-3-(thiazinan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 135284918 |
| Molecular Formula | C19H20F2N2OS |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(3,5-difluorocarbazol-9-yl)-3-(thiazinan-2-yl)propan-2-ol |
| SMILES | OC(CN1CCCCS1)Cn1c2ccc(F)cc2c2c(F)cccc21 |
| InChI | InChI=1S/C19H20F2N2OS/c20-13-6-7-17-15(10-13)19-16(21)4-3-5-18(19)23(17)12-14(24)11-22-8-1-2-9-25-22/h3-7,10,14,24H,1-2,8-9,11-12H2 |
| InChIKey | RTBZTCZPOKDWEE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|