C24H29F2N3OS — CID 135284887
1-(5-cyclohexyl-1,2,5-thiadiazinan-2-yl)-3-(3,6-difluorocarbazol-9-yl)propan-2-ol (PubChem CID 135284887) has the molecular formula C24H29F2N3OS and a molecular weight of 445.58 g/mol. Its IUPAC name is 1-(5-cyclohexyl-1,2,5-thiadiazinan-2-yl)-3-(3,6-difluorocarbazol-9-yl)propan-2-ol.
| Compound Name | 1-(5-cyclohexyl-1,2,5-thiadiazinan-2-yl)-3-(3,6-difluorocarbazol-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 135284887 |
| Molecular Formula | C24H29F2N3OS |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-(5-cyclohexyl-1,2,5-thiadiazinan-2-yl)-3-(3,6-difluorocarbazol-9-yl)propan-2-ol |
| SMILES | OC(CN1CCN(C2CCCCC2)CS1)Cn1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C24H29F2N3OS/c25-17-6-8-23-21(12-17)22-13-18(26)7-9-24(22)29(23)15-20(30)14-28-11-10-27(16-31-28)19-4-2-1-3-5-19/h6-9,12-13,19-20,30H,1-5,10-11,14-16H2 |
| InChIKey | JPEJAFLQXSULLD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|