C18H19F2N3OS — CID 135284908
1-(3,6-difluorocarbazol-9-yl)-3-(1,2,6-thiadiazinan-2-yl)propan-2-ol (PubChem CID 135284908) has the molecular formula C18H19F2N3OS and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-(3,6-difluorocarbazol-9-yl)-3-(1,2,6-thiadiazinan-2-yl)propan-2-ol.
| Compound Name | 1-(3,6-difluorocarbazol-9-yl)-3-(1,2,6-thiadiazinan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 135284908 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(3,6-difluorocarbazol-9-yl)-3-(1,2,6-thiadiazinan-2-yl)propan-2-ol |
| SMILES | OC(CN1CCCNS1)Cn1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C18H19F2N3OS/c19-12-2-4-17-15(8-12)16-9-13(20)3-5-18(16)23(17)11-14(24)10-22-7-1-6-21-25-22/h2-5,8-9,14,21,24H,1,6-7,10-11H2 |
| InChIKey | DLUAGJQXKGJULU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|