C14H20N6Na2S2 — CID 126957358
DISODIUM 4-ALLYL-5-[4-(4-ALLYL-5-SULFIDO-4H-1,2,4-TRIAZOL-3-YL)BUTYL]-4H-1,2,4-TRIAZOL-3-YLSULFIDE (PubChem CID 126957358) has the molecular formula C14H20N6Na2S2 and a molecular weight of 382.47 g/mol.
| Compound Name | DISODIUM 4-ALLYL-5-[4-(4-ALLYL-5-SULFIDO-4H-1,2,4-TRIAZOL-3-YL)BUTYL]-4H-1,2,4-TRIAZOL-3-YLSULFIDE |
|---|---|
| PubChem CID | 126957358 |
| Molecular Formula | C14H20N6Na2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | — |
| SMILES | C=CCn1c(CCCCc2n[nH]c(=S)n2CC=C)n[nH]c1=S.[Na].[Na] |
| InChI | InChI=1S/C14H20N6S2.2Na/c1-3-9-19-11(15-17-13(19)21)7-5-6-8-12-16-18-14(22)20(12)10-4-2;;/h3-4H,1-2,5-10H2,(H,17,21)(H,18,22);; |
| InChIKey | UKZIFALASIUQNX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|