C18H18N3OPS — CID 135398278
3-(diphenylphosphorylmethyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione (PubChem CID 135398278) has the molecular formula C18H18N3OPS and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-(diphenylphosphorylmethyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(diphenylphosphorylmethyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135398278 |
| Molecular Formula | C18H18N3OPS |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-(diphenylphosphorylmethyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
| SMILES | C=CCn1c(CP(=O)(c2ccccc2)c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C18H18N3OPS/c1-2-13-21-17(19-20-18(21)24)14-23(22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h2-12H,1,13-14H2,(H,20,24) |
| InChIKey | XPXBZHSGIDJAKR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|