C14H14Cl2NO2+ — CID 126957909
3,5-dichloro-1-hydroxy-2,6-dimethyl-4-(4-methylphenoxy)pyridin-1-ium (PubChem CID 126957909) has the molecular formula C14H14Cl2NO2+ and a molecular weight of 299.18 g/mol. Its IUPAC name is 3,5-dichloro-1-hydroxy-2,6-dimethyl-4-(4-methylphenoxy)pyridin-1-ium.
| Compound Name | 3,5-dichloro-1-hydroxy-2,6-dimethyl-4-(4-methylphenoxy)pyridin-1-ium |
|---|---|
| PubChem CID | 126957909 |
| Molecular Formula | C14H14Cl2NO2+ |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3,5-dichloro-1-hydroxy-2,6-dimethyl-4-(4-methylphenoxy)pyridin-1-ium |
| SMILES | Cc1ccc(Oc2c(Cl)c(C)[n+](O)c(C)c2Cl)cc1 |
| InChI | InChI=1S/C14H14Cl2NO2/c1-8-4-6-11(7-5-8)19-14-12(15)9(2)17(18)10(3)13(14)16/h4-7,18H,1-3H3/q+1 |
| InChIKey | RMPYWQARPFYZII-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|