C20H15BrFN2O+ — CID 126958306
1-(4-fluorophenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone;hydrobromide (PubChem CID 126958306) has the molecular formula C20H15BrFN2O+ and a molecular weight of 398.26 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone;hydrobromide.
| Compound Name | 1-(4-fluorophenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 126958306 |
| Molecular Formula | C20H15BrFN2O+ |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 1-(4-fluorophenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone;hydrobromide |
| SMILES | Br.O=C(C[n+]1cccc2ccc3cccnc3c21)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H14FN2O.BrH/c21-17-9-7-14(8-10-17)18(24)13-23-12-2-4-16-6-5-15-3-1-11-22-19(15)20(16)23;/h1-12H,13H2;1H/q+1; |
| InChIKey | PSLAMDQXSGAYSH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|