C15H34N4S4+2 — CID 126960093
diazanium;4-[3-(1-dithiocarboxypiperidin-4-yl)propyl]piperidine-1-carbodithioic acid (PubChem CID 126960093) has the molecular formula C15H34N4S4+2 and a molecular weight of 398.73 g/mol. Its IUPAC name is diazanium;4-[3-(1-dithiocarboxypiperidin-4-yl)propyl]piperidine-1-carbodithioic acid.
| Compound Name | diazanium;4-[3-(1-dithiocarboxypiperidin-4-yl)propyl]piperidine-1-carbodithioic acid |
|---|---|
| PubChem CID | 126960093 |
| Molecular Formula | C15H34N4S4+2 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | diazanium;4-[3-(1-dithiocarboxypiperidin-4-yl)propyl]piperidine-1-carbodithioic acid |
| SMILES | S=C(S)N1CCC(CCCC2CCN(C(=S)S)CC2)CC1.[NH4+].[NH4+] |
| InChI | InChI=1S/C15H26N2S4.2H3N/c18-14(19)16-8-4-12(5-9-16)2-1-3-13-6-10-17(11-7-13)15(20)21;;/h12-13H,1-11H2,(H,18,19)(H,20,21);2*1H3/p+2 |
| InChIKey | ZSKGIEKJVHLYEJ-UHFFFAOYSA-P |
| XLogP | 4.76 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|