bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid

C5H11BiFNS2 — CID 174724747

IUPACbismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid
SMILESF[C@H]1CCN(C(=S)S)C1.[BiH3]
InChIInChI=1S/C5H8FNS2.Bi.3H/c6-4-1-2-7(3-4)5(8)9;;;;/h4H,1-3H2,(H,8,9);;;;/t4-;;;;/m0..../s1
InChIKeyRTYIYQFRDAYJKI-NDNWHDOQSA-N
MW377.26 g/mol
LogP0.06
Rot. Bonds

About bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid

bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid (PubChem CID 174724747) has the molecular formula C5H11BiFNS2 and a molecular weight of 377.26 g/mol. Its IUPAC name is bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid.

Molecular Properties

Compound Namebismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid
PubChem CID174724747
Molecular FormulaC5H11BiFNS2
Molecular Weight377.26 g/mol
Exact Mass377.01
IUPAC Namebismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid
SMILESF[C@H]1CCN(C(=S)S)C1.[BiH3]
InChIInChI=1S/C5H8FNS2.Bi.3H/c6-4-1-2-7(3-4)5(8)9;;;;/h4H,1-3H2,(H,8,9);;;;/t4-;;;;/m0..../s1
InChIKeyRTYIYQFRDAYJKI-NDNWHDOQSA-N
XLogP0.06
TPSA3.24 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500377.26
LogP ≤ 50.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
The IUPAC name of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid (CID 174724747) is bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid.
What is the SMILES notation for bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
The canonical SMILES for bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid is F[C@H]1CCN(C(=S)S)C1.[BiH3].
What is the InChIKey of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
The InChIKey is RTYIYQFRDAYJKI-NDNWHDOQSA-N. The full InChI is InChI=1S/C5H8FNS2.Bi.3H/c6-4-1-2-7(3-4)5(8)9;;;;/h4H,1-3H2,(H,8,9);;;;/t4-;;;;/m0..../s1.
What are the key properties of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid has a molecular weight of 377.26 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid is sourced from PubChem (CID 174724747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).