About bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid
bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid (PubChem CID 174724747) has the molecular formula C5H11BiFNS2
and a molecular weight of 377.26 g/mol. Its IUPAC name is bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid.
Molecular Properties
| Compound Name | bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid |
| PubChem CID | 174724747 |
| Molecular Formula | C5H11BiFNS2 |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid |
| SMILES | F[C@H]1CCN(C(=S)S)C1.[BiH3] |
| InChI | InChI=1S/C5H8FNS2.Bi.3H/c6-4-1-2-7(3-4)5(8)9;;;;/h4H,1-3H2,(H,8,9);;;;/t4-;;;;/m0..../s1 |
| InChIKey | RTYIYQFRDAYJKI-NDNWHDOQSA-N |
| XLogP | 0.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
The IUPAC name of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid (CID 174724747) is bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid.
What is the SMILES notation for bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
The canonical SMILES for bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid is F[C@H]1CCN(C(=S)S)C1.[BiH3].
What is the InChIKey of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
The InChIKey is RTYIYQFRDAYJKI-NDNWHDOQSA-N. The full InChI is InChI=1S/C5H8FNS2.Bi.3H/c6-4-1-2-7(3-4)5(8)9;;;;/h4H,1-3H2,(H,8,9);;;;/t4-;;;;/m0..../s1.
What are the key properties of bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid?
bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid has a molecular weight of 377.26 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;(3S)-3-fluoropyrrolidine-1-carbodithioic acid is sourced from PubChem (CID 174724747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).